C47H52N2 — CID 89017140
2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(3,4,7,8-tetrahydronaphthalen-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine (PubChem CID 89017140) has the molecular formula C47H52N2 and a molecular weight of 644.95 g/mol. Its IUPAC name is 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(3,4,7,8-tetrahydronaphthalen-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine.
| Compound Name | 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(3,4,7,8-tetrahydronaphthalen-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 89017140 |
| Molecular Formula | C47H52N2 |
| Molecular Weight | 644.95 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | 2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-2-N,7-N-bis(3,4,7,8-tetrahydronaphthalen-1-yl)-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
| SMILES | CC1(C)C2=C(CCC(N(C3=CCCC4=C3CCC=C4)C3C=CC=CC3)=C2)C2=CC=C(N(C3=CCCC4=C3CCC=C4)C3C=CC=CC3)CC21 |
| InChI | InChI=1S/C47H52N2/c1-47(2)43-31-37(48(35-19-5-3-6-20-35)45-25-13-17-33-15-9-11-23-39(33)45)27-29-41(43)42-30-28-38(32-44(42)47)49(36-21-7-4-8-22-36)46-26-14-18-34-16-10-12-24-40(34)46/h3-10,15-16,19,21,25-27,29,32,35-36,43H,11-14,17-18,20,22-24,28,30-31H2,1-2H3 |
| InChIKey | UDCZPRWZABAYJP-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.95 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |