C39H44N2 — CID 89017170
2-N,7-N-di(cyclohexa-1,5-dien-1-yl)-2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine (PubChem CID 89017170) has the molecular formula C39H44N2 and a molecular weight of 540.80 g/mol. Its IUPAC name is 2-N,7-N-di(cyclohexa-1,5-dien-1-yl)-2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine.
| Compound Name | 2-N,7-N-di(cyclohexa-1,5-dien-1-yl)-2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
|---|---|
| PubChem CID | 89017170 |
| Molecular Formula | C39H44N2 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | 2-N,7-N-di(cyclohexa-1,5-dien-1-yl)-2-N,7-N-di(cyclohexa-2,4-dien-1-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene-2,7-diamine |
| SMILES | CC1(C)C2=C(CCC(N(C3=CCCC=C3)C3C=CC=CC3)=C2)C2=CC=C(N(C3=CCCC=C3)C3C=CC=CC3)CC21 |
| InChI | InChI=1S/C39H44N2/c1-39(2)37-27-33(40(29-15-7-3-8-16-29)30-17-9-4-10-18-30)23-25-35(37)36-26-24-34(28-38(36)39)41(31-19-11-5-12-20-31)32-21-13-6-14-22-32/h3,5,7-9,11-13,15,17-19,21-23,25,28-29,31,37H,4,6,10,14,16,20,24,26-27H2,1-2H3 |
| InChIKey | QCXOQNAUQCPNHR-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |