C12H22N2O — CID 89017359
(3E,4Z)-2-amino-3-(1-aminobutylidene)-5-methylhepta-4,6-dien-2-ol (PubChem CID 89017359) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (3E,4Z)-2-amino-3-(1-aminobutylidene)-5-methylhepta-4,6-dien-2-ol.
| Compound Name | (3E,4Z)-2-amino-3-(1-aminobutylidene)-5-methylhepta-4,6-dien-2-ol |
|---|---|
| PubChem CID | 89017359 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (3E,4Z)-2-amino-3-(1-aminobutylidene)-5-methylhepta-4,6-dien-2-ol |
| SMILES | C=C/C(C)=C\C(=C(/N)CCC)C(C)(N)O |
| InChI | InChI=1S/C12H22N2O/c1-5-7-11(13)10(12(4,14)15)8-9(3)6-2/h6,8,15H,2,5,7,13-14H2,1,3-4H3/b9-8-,11-10+ |
| InChIKey | NKQUOARLYVOLNS-QNRZBPGKSA-N |
| XLogP | 1.80 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|