About N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide
N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide (PubChem CID 89017374) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide |
| PubChem CID | 89017374 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide |
| SMILES | CC(=O)NCC1=CC(Cl)=CCC1 |
| InChI | InChI=1S/C9H12ClNO/c1-7(12)11-6-8-3-2-4-9(10)5-8/h4-5H,2-3,6H2,1H3,(H,11,12) |
| InChIKey | VSDFCPCWXIOUHX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide?
The IUPAC name of N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide (CID 89017374) is N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide.
What is the SMILES notation for N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide?
The canonical SMILES for N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide is CC(=O)NCC1=CC(Cl)=CCC1.
What is the InChIKey of N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide?
The InChIKey is VSDFCPCWXIOUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNO/c1-7(12)11-6-8-3-2-4-9(10)5-8/h4-5H,2-3,6H2,1H3,(H,11,12).
What are the key properties of N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide?
N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide has a molecular weight of 185.65 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chlorocyclohexa-1,3-dien-1-yl)methyl]acetamide is sourced from PubChem (CID 89017374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).