About N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide
N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide (PubChem CID 89017610) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide |
| PubChem CID | 89017610 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CC[C@@H](C)C=C1 |
| InChI | InChI=1S/C9H13NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3,5-7H,4H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | KKRRTVODHKIVNN-ZETCQYMHSA-N |
| XLogP | 1.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide?
The IUPAC name of N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide (CID 89017610) is N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide.
What is the SMILES notation for N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide?
The canonical SMILES for N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide is CC(=O)NC1=CC[C@@H](C)C=C1.
What is the InChIKey of N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide?
The InChIKey is KKRRTVODHKIVNN-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3,5-7H,4H2,1-2H3,(H,10,11)/t7-/m0/s1.
What are the key properties of N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide?
N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide has a molecular weight of 151.21 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R)-4-methylcyclohexa-1,5-dien-1-yl]acetamide is sourced from PubChem (CID 89017610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).