About 6,8-dimethyl-4H-1,3-benzodioxine
6,8-dimethyl-4H-1,3-benzodioxine (PubChem CID 89017859) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 6,8-dimethyl-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 6,8-dimethyl-4H-1,3-benzodioxine |
| PubChem CID | 89017859 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 6,8-dimethyl-4H-1,3-benzodioxine |
| SMILES | Cc1cc(C)c2c(c1)COCO2 |
| InChI | InChI=1S/C10H12O2/c1-7-3-8(2)10-9(4-7)5-11-6-12-10/h3-4H,5-6H2,1-2H3 |
| InChIKey | OBUYZLQHMZCNEQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dimethyl-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethyl-4H-1,3-benzodioxine?
The IUPAC name of 6,8-dimethyl-4H-1,3-benzodioxine (CID 89017859) is 6,8-dimethyl-4H-1,3-benzodioxine.
What is the SMILES notation for 6,8-dimethyl-4H-1,3-benzodioxine?
The canonical SMILES for 6,8-dimethyl-4H-1,3-benzodioxine is Cc1cc(C)c2c(c1)COCO2.
What is the InChIKey of 6,8-dimethyl-4H-1,3-benzodioxine?
The InChIKey is OBUYZLQHMZCNEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-7-3-8(2)10-9(4-7)5-11-6-12-10/h3-4H,5-6H2,1-2H3.
What are the key properties of 6,8-dimethyl-4H-1,3-benzodioxine?
6,8-dimethyl-4H-1,3-benzodioxine has a molecular weight of 164.20 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-4H-1,3-benzodioxine is sourced from PubChem (CID 89017859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).