C11H12Br2 — CID 89018164
6,7-dibromo-3-methylidene-2,4,4a,8a-tetrahydro-1H-naphthalene (PubChem CID 89018164) has the molecular formula C11H12Br2 and a molecular weight of 304.03 g/mol. Its IUPAC name is 6,7-dibromo-3-methylidene-2,4,4a,8a-tetrahydro-1H-naphthalene.
| Compound Name | 6,7-dibromo-3-methylidene-2,4,4a,8a-tetrahydro-1H-naphthalene |
|---|---|
| PubChem CID | 89018164 |
| Molecular Formula | C11H12Br2 |
| Molecular Weight | 304.03 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | 6,7-dibromo-3-methylidene-2,4,4a,8a-tetrahydro-1H-naphthalene |
| SMILES | C=C1CCC2C=C(Br)C(Br)=CC2C1 |
| InChI | InChI=1S/C11H12Br2/c1-7-2-3-8-5-10(12)11(13)6-9(8)4-7/h5-6,8-9H,1-4H2 |
| InChIKey | ZUPKZZRFNDGFJO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.03 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|