About 5-methoxyoct-7-en-4-one
5-methoxyoct-7-en-4-one (PubChem CID 89018208) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 5-methoxyoct-7-en-4-one.
Molecular Properties
| Compound Name | 5-methoxyoct-7-en-4-one |
| PubChem CID | 89018208 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 5-methoxyoct-7-en-4-one |
| SMILES | C=CCC(OC)C(=O)CCC |
| InChI | InChI=1S/C9H16O2/c1-4-6-8(10)9(11-3)7-5-2/h5,9H,2,4,6-7H2,1,3H3 |
| InChIKey | JALUJSLFYFFWOC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxyoct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxyoct-7-en-4-one?
The IUPAC name of 5-methoxyoct-7-en-4-one (CID 89018208) is 5-methoxyoct-7-en-4-one.
What is the SMILES notation for 5-methoxyoct-7-en-4-one?
The canonical SMILES for 5-methoxyoct-7-en-4-one is C=CCC(OC)C(=O)CCC.
What is the InChIKey of 5-methoxyoct-7-en-4-one?
The InChIKey is JALUJSLFYFFWOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-4-6-8(10)9(11-3)7-5-2/h5,9H,2,4,6-7H2,1,3H3.
What are the key properties of 5-methoxyoct-7-en-4-one?
5-methoxyoct-7-en-4-one has a molecular weight of 156.22 g/mol, XLogP of 1.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxyoct-7-en-4-one is sourced from PubChem (CID 89018208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).