About CID 89018260
CID 89018260 (PubChem CID 89018260) has the molecular formula C8H10BN
and a molecular weight of 130.99 g/mol.
Molecular Properties
| Compound Name | CID 89018260 |
| PubChem CID | 89018260 |
| Molecular Formula | C8H10BN |
| Molecular Weight | 130.99 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccccc1CCN |
| InChI | InChI=1S/C8H10BN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2 |
| InChIKey | SYEGQZCUUNRANY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.99 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89018260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89018260?
The IUPAC name of CID 89018260 (CID 89018260) is not available.
What is the SMILES notation for CID 89018260?
The canonical SMILES for CID 89018260 is [B]c1ccccc1CCN.
What is the InChIKey of CID 89018260?
The InChIKey is SYEGQZCUUNRANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2.
What are the key properties of CID 89018260?
CID 89018260 has a molecular weight of 130.99 g/mol, XLogP of -0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89018260 is sourced from PubChem (CID 89018260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).