C14H13F6N3O — CID 89018336
N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 89018336) has the molecular formula C14H13F6N3O and a molecular weight of 353.27 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89018336 |
| Molecular Formula | C14H13F6N3O |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | C=C/C=C\C(=C/C)NC(=O)c1cnn(CC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C14H13F6N3O/c1-3-5-6-9(4-2)22-12(24)10-7-21-23(8-13(15,16)17)11(10)14(18,19)20/h3-7H,1,8H2,2H3,(H,22,24)/b6-5-,9-4+ |
| InChIKey | URURLYXVTPSBBG-CXBDEZGUSA-N |
| XLogP | 3.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|