About 3,3-diethyloxolane
3,3-diethyloxolane (PubChem CID 89018389) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is 3,3-diethyloxolane.
Molecular Properties
| Compound Name | 3,3-diethyloxolane |
| PubChem CID | 89018389 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 3,3-diethyloxolane |
| SMILES | CCC1(CC)CCOC1 |
| InChI | InChI=1S/C8H16O/c1-3-8(4-2)5-6-9-7-8/h3-7H2,1-2H3 |
| InChIKey | PPVZAMMUBCHBDQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyloxolane?
The IUPAC name of 3,3-diethyloxolane (CID 89018389) is 3,3-diethyloxolane.
What is the SMILES notation for 3,3-diethyloxolane?
The canonical SMILES for 3,3-diethyloxolane is CCC1(CC)CCOC1.
What is the InChIKey of 3,3-diethyloxolane?
The InChIKey is PPVZAMMUBCHBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-3-8(4-2)5-6-9-7-8/h3-7H2,1-2H3.
What are the key properties of 3,3-diethyloxolane?
3,3-diethyloxolane has a molecular weight of 128.22 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyloxolane is sourced from PubChem (CID 89018389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).