C10H16O4 — CID 89018904
5-(methoxymethoxy)-1-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one (PubChem CID 89018904) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 5-(methoxymethoxy)-1-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one.
| Compound Name | 5-(methoxymethoxy)-1-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 89018904 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-(methoxymethoxy)-1-methyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-3-one |
| SMILES | COCOC1CC2C(=O)OC(C)C2C1 |
| InChI | InChI=1S/C10H16O4/c1-6-8-3-7(13-5-12-2)4-9(8)10(11)14-6/h6-9H,3-5H2,1-2H3 |
| InChIKey | UCJHPSXNHNFGII-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|