About [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate
[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate (PubChem CID 89018980) has the molecular formula C9H21O6P
and a molecular weight of 256.23 g/mol. Its IUPAC name is [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate |
| PubChem CID | 89018980 |
| Molecular Formula | C9H21O6P |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate |
| SMILES | CC(C)(CO)COCC(C)(C)OP(=O)(O)O |
| InChI | InChI=1S/C9H21O6P/c1-8(2,5-10)6-14-7-9(3,4)15-16(11,12)13/h10H,5-7H2,1-4H3,(H2,11,12,13) |
| InChIKey | ZFBKOVDXGTWVRJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate?
The IUPAC name of [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate (CID 89018980) is [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate.
What is the SMILES notation for [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate?
The canonical SMILES for [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate is CC(C)(CO)COCC(C)(C)OP(=O)(O)O.
What is the InChIKey of [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate?
The InChIKey is ZFBKOVDXGTWVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O6P/c1-8(2,5-10)6-14-7-9(3,4)15-16(11,12)13/h10H,5-7H2,1-4H3,(H2,11,12,13).
What are the key properties of [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate?
[1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate has a molecular weight of 256.23 g/mol, XLogP of 0.91, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-hydroxy-2,2-dimethylpropoxy)-2-methylpropan-2-yl] dihydrogen phosphate is sourced from PubChem (CID 89018980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).