About 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid
2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid (PubChem CID 89019062) has the molecular formula C15H30O4
and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid.
Analyze 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid (CID 89019062) is 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid is CCC(CC)(CCO)COCC(CC)(CC)C(=O)O.
What is the InChIKey of 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid?
The InChIKey is CHSONICECAQICY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O4/c1-5-14(6-2,9-10-16)11-19-12-15(7-3,8-4)13(17)18/h16H,5-12H2,1-4H3,(H,17,18).
What are the key properties of 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid?
2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid has a molecular weight of 274.40 g/mol, XLogP of 3.08, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-diethyl-4-hydroxybutoxy)methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 89019062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).