About 2-[(2S)-butan-2-yl]-1,3-oxazole
2-[(2S)-butan-2-yl]-1,3-oxazole (PubChem CID 89019255) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-[(2S)-butan-2-yl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(2S)-butan-2-yl]-1,3-oxazole |
| PubChem CID | 89019255 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-[(2S)-butan-2-yl]-1,3-oxazole |
| SMILES | CC[C@H](C)c1ncco1 |
| InChI | InChI=1S/C7H11NO/c1-3-6(2)7-8-4-5-9-7/h4-6H,3H2,1-2H3/t6-/m0/s1 |
| InChIKey | VMVNFVMIKMIETB-LURJTMIESA-N |
| XLogP | 2.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-butan-2-yl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-butan-2-yl]-1,3-oxazole?
The IUPAC name of 2-[(2S)-butan-2-yl]-1,3-oxazole (CID 89019255) is 2-[(2S)-butan-2-yl]-1,3-oxazole.
What is the SMILES notation for 2-[(2S)-butan-2-yl]-1,3-oxazole?
The canonical SMILES for 2-[(2S)-butan-2-yl]-1,3-oxazole is CC[C@H](C)c1ncco1.
What is the InChIKey of 2-[(2S)-butan-2-yl]-1,3-oxazole?
The InChIKey is VMVNFVMIKMIETB-LURJTMIESA-N. The full InChI is InChI=1S/C7H11NO/c1-3-6(2)7-8-4-5-9-7/h4-6H,3H2,1-2H3/t6-/m0/s1.
What are the key properties of 2-[(2S)-butan-2-yl]-1,3-oxazole?
2-[(2S)-butan-2-yl]-1,3-oxazole has a molecular weight of 125.17 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-butan-2-yl]-1,3-oxazole is sourced from PubChem (CID 89019255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).