About [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate
[N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate (PubChem CID 89019311) has the molecular formula C13H19FN4S
and a molecular weight of 282.39 g/mol. Its IUPAC name is [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate.
Molecular Properties
| Compound Name | [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate |
| PubChem CID | 89019311 |
| Molecular Formula | C13H19FN4S |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(N)=N/CCCCCN)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FN4S/c14-11-6-4-10(5-7-11)12(16)19-13(17)18-9-3-1-2-8-15/h4-7,16H,1-3,8-9,15H2,(H2,17,18)/b16-12- |
| InChIKey | MITWYABNCGZAJX-VBKFSLOCSA-N |
| XLogP | 2.33 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate?
The IUPAC name of [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate (CID 89019311) is [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate.
What is the SMILES notation for [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate?
The canonical SMILES for [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate is [H]/N=C(\S/C(N)=N/CCCCCN)c1ccc(F)cc1.
What is the InChIKey of [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate?
The InChIKey is MITWYABNCGZAJX-VBKFSLOCSA-N. The full InChI is InChI=1S/C13H19FN4S/c14-11-6-4-10(5-7-11)12(16)19-13(17)18-9-3-1-2-8-15/h4-7,16H,1-3,8-9,15H2,(H2,17,18)/b16-12-.
What are the key properties of [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate?
[N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate has a molecular weight of 282.39 g/mol, XLogP of 2.33, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(5-aminopentyl)carbamimidoyl] 4-fluorobenzenecarboximidothioate is sourced from PubChem (CID 89019311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).