About N,3-dimethyl-2,7-naphthyridin-1-amine
N,3-dimethyl-2,7-naphthyridin-1-amine (PubChem CID 89019478) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is N,3-dimethyl-2,7-naphthyridin-1-amine.
Molecular Properties
| Compound Name | N,3-dimethyl-2,7-naphthyridin-1-amine |
| PubChem CID | 89019478 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N,3-dimethyl-2,7-naphthyridin-1-amine |
| SMILES | CNc1nc(C)cc2ccncc12 |
| InChI | InChI=1S/C10H11N3/c1-7-5-8-3-4-12-6-9(8)10(11-2)13-7/h3-6H,1-2H3,(H,11,13) |
| InChIKey | KFEMEKHPNQYFKC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,3-dimethyl-2,7-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-2,7-naphthyridin-1-amine?
The IUPAC name of N,3-dimethyl-2,7-naphthyridin-1-amine (CID 89019478) is N,3-dimethyl-2,7-naphthyridin-1-amine.
What is the SMILES notation for N,3-dimethyl-2,7-naphthyridin-1-amine?
The canonical SMILES for N,3-dimethyl-2,7-naphthyridin-1-amine is CNc1nc(C)cc2ccncc12.
What is the InChIKey of N,3-dimethyl-2,7-naphthyridin-1-amine?
The InChIKey is KFEMEKHPNQYFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c1-7-5-8-3-4-12-6-9(8)10(11-2)13-7/h3-6H,1-2H3,(H,11,13).
What are the key properties of N,3-dimethyl-2,7-naphthyridin-1-amine?
N,3-dimethyl-2,7-naphthyridin-1-amine has a molecular weight of 173.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-2,7-naphthyridin-1-amine is sourced from PubChem (CID 89019478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).