(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid

C10H12O4 — CID 89019578

IUPAC(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid
SMILESO=C1OCCC2C=CC[C@H](C(=O)O)C12
InChIInChI=1S/C10H12O4/c11-9(12)7-3-1-2-6-4-5-14-10(13)8(6)7/h1-2,6-8H,3-5H2,(H,11,12)/t6?,7-,8?/m0/s1
InChIKeyWZEOJUJSIQOPDY-WTIBDHCWSA-N
MW196.20 g/mol
LogP0.83
Rot. Bonds1

About (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid

(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid (PubChem CID 89019578) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid.

Molecular Properties

Compound Name(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid
PubChem CID89019578
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid
SMILESO=C1OCCC2C=CC[C@H](C(=O)O)C12
InChIInChI=1S/C10H12O4/c11-9(12)7-3-1-2-6-4-5-14-10(13)8(6)7/h1-2,6-8H,3-5H2,(H,11,12)/t6?,7-,8?/m0/s1
InChIKeyWZEOJUJSIQOPDY-WTIBDHCWSA-N
XLogP0.83
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 50.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid?
The IUPAC name of (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid (CID 89019578) is (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid.
What is the SMILES notation for (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid?
The canonical SMILES for (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid is O=C1OCCC2C=CC[C@H](C(=O)O)C12.
What is the InChIKey of (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid?
The InChIKey is WZEOJUJSIQOPDY-WTIBDHCWSA-N. The full InChI is InChI=1S/C10H12O4/c11-9(12)7-3-1-2-6-4-5-14-10(13)8(6)7/h1-2,6-8H,3-5H2,(H,11,12)/t6?,7-,8?/m0/s1.
What are the key properties of (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid?
(8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid has a molecular weight of 196.20 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-1-oxo-3,4,4a,7,8,8a-hexahydroisochromene-8-carboxylic acid is sourced from PubChem (CID 89019578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).