C24H48NO9P — CID 89019855
[(2S)-1-(8-acetamidooctoxymethoxy)-3-phosphonooxypropan-2-yl] decanoate (PubChem CID 89019855) has the molecular formula C24H48NO9P and a molecular weight of 525.62 g/mol. Its IUPAC name is [(2S)-1-(8-acetamidooctoxymethoxy)-3-phosphonooxypropan-2-yl] decanoate.
| Compound Name | [(2S)-1-(8-acetamidooctoxymethoxy)-3-phosphonooxypropan-2-yl] decanoate |
|---|---|
| PubChem CID | 89019855 |
| Molecular Formula | C24H48NO9P |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | [(2S)-1-(8-acetamidooctoxymethoxy)-3-phosphonooxypropan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](COCOCCCCCCCCNC(C)=O)COP(=O)(O)O |
| InChI | InChI=1S/C24H48NO9P/c1-3-4-5-6-7-10-13-16-24(27)34-23(20-33-35(28,29)30)19-32-21-31-18-15-12-9-8-11-14-17-25-22(2)26/h23H,3-21H2,1-2H3,(H,25,26)(H2,28,29,30)/t23-/m0/s1 |
| InChIKey | FTGPLLWSWGBALJ-QHCPKHFHSA-N |
| XLogP | 4.62 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|