About 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one
6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 8901989) has the molecular formula C19H15ClN4O3
and a molecular weight of 382.81 g/mol. Its IUPAC name is 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one |
| PubChem CID | 8901989 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | Cc1cc(C(=O)Cn2cnc3ccc(Cl)cc3c2=O)c(C)n1-c1ccon1 |
| InChI | InChI=1S/C19H15ClN4O3/c1-11-7-14(12(2)24(11)18-5-6-27-22-18)17(25)9-23-10-21-16-4-3-13(20)8-15(16)19(23)26/h3-8,10H,9H2,1-2H3 |
| InChIKey | BIMFDVKOMFACGC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one?
The IUPAC name of 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one (CID 8901989) is 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one.
What is the SMILES notation for 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one?
The canonical SMILES for 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one is Cc1cc(C(=O)Cn2cnc3ccc(Cl)cc3c2=O)c(C)n1-c1ccon1.
What is the InChIKey of 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one?
The InChIKey is BIMFDVKOMFACGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN4O3/c1-11-7-14(12(2)24(11)18-5-6-27-22-18)17(25)9-23-10-21-16-4-3-13(20)8-15(16)19(23)26/h3-8,10H,9H2,1-2H3.
What are the key properties of 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one?
6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one has a molecular weight of 382.81 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[2-[2,5-dimethyl-1-(1,2-oxazol-3-yl)pyrrol-3-yl]-2-oxoethyl]quinazolin-4-one is sourced from PubChem (CID 8901989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).