About [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate
[(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate (PubChem CID 89019957) has the molecular formula C21H40NO6P
and a molecular weight of 433.53 g/mol. Its IUPAC name is [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate.
Molecular Properties
| Compound Name | [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate |
| PubChem CID | 89019957 |
| Molecular Formula | C21H40NO6P |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate |
| SMILES | CCCCCCCC(=O)O[C@@H](COP=O)COC(=O)CCCCCCCCCN |
| InChI | InChI=1S/C21H40NO6P/c1-2-3-4-8-12-15-21(24)28-19(18-27-29-25)17-26-20(23)14-11-9-6-5-7-10-13-16-22/h19H,2-18,22H2,1H3/t19-/m1/s1 |
| InChIKey | BERXVWUXIRAXMV-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate?
The IUPAC name of [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate (CID 89019957) is [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate.
What is the SMILES notation for [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate?
The canonical SMILES for [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate is CCCCCCCC(=O)O[C@@H](COP=O)COC(=O)CCCCCCCCCN.
What is the InChIKey of [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate?
The InChIKey is BERXVWUXIRAXMV-LJQANCHMSA-N. The full InChI is InChI=1S/C21H40NO6P/c1-2-3-4-8-12-15-21(24)28-19(18-27-29-25)17-26-20(23)14-11-9-6-5-7-10-13-16-22/h19H,2-18,22H2,1H3/t19-/m1/s1.
What are the key properties of [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate?
[(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate has a molecular weight of 433.53 g/mol, XLogP of 5.10, 21 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-octanoyloxy-3-phosphorosooxypropyl] 10-aminodecanoate is sourced from PubChem (CID 89019957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).