C15H14F4N6O — CID 89020297
4-amino-5-(4-amino-3-fluorophenyl)-N-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 89020297) has the molecular formula C15H14F4N6O and a molecular weight of 370.31 g/mol. Its IUPAC name is 4-amino-5-(4-amino-3-fluorophenyl)-N-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-amino-5-(4-amino-3-fluorophenyl)-N-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 89020297 |
| Molecular Formula | C15H14F4N6O |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-amino-5-(4-amino-3-fluorophenyl)-N-(2,2,2-trifluoroethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | NC1=NC=NN2CC(C(=O)NCC(F)(F)F)C(c3ccc(N)c(F)c3)=C12 |
| InChI | InChI=1S/C15H14F4N6O/c16-9-3-7(1-2-10(9)20)11-8(14(26)22-5-15(17,18)19)4-25-12(11)13(21)23-6-24-25/h1-3,6,8H,4-5,20H2,(H,22,26)(H2,21,23,24) |
| InChIKey | CNDDERLXWKSKOI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|