C12H16N4S — CID 89020480
(1Z,3E)-3-(4-cyclopropyl-5-methylsulfanyl-1,2,4-triazol-3-yl)hexa-1,3,5-trien-1-amine (PubChem CID 89020480) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is (1Z,3E)-3-(4-cyclopropyl-5-methylsulfanyl-1,2,4-triazol-3-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(4-cyclopropyl-5-methylsulfanyl-1,2,4-triazol-3-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89020480 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (1Z,3E)-3-(4-cyclopropyl-5-methylsulfanyl-1,2,4-triazol-3-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)c1nnc(SC)n1C1CC1 |
| InChI | InChI=1S/C12H16N4S/c1-3-4-9(7-8-13)11-14-15-12(17-2)16(11)10-5-6-10/h3-4,7-8,10H,1,5-6,13H2,2H3/b8-7-,9-4+ |
| InChIKey | JNJZXYUDNPMDFD-TZRLODCYSA-N |
| XLogP | 2.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|