C24H43NO7 — CID 89020601
N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide (PubChem CID 89020601) has the molecular formula C24H43NO7 and a molecular weight of 457.61 g/mol. Its IUPAC name is N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide.
| Compound Name | N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
|---|---|
| PubChem CID | 89020601 |
| Molecular Formula | C24H43NO7 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.30 |
| IUPAC Name | N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-hydroxy-5,5-dimethyloxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide |
| SMILES | C=C1C[C@@](CC(=O)NC[C@@H]2C[C@@H](O)C(C)(C)[C@@H](C[C@@H](COC)OC)O2)(OC)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H43NO7/c1-15-11-24(30-8,32-17(3)16(15)2)12-22(27)25-13-18-9-20(26)23(4,5)21(31-18)10-19(29-7)14-28-6/h16-21,26H,1,9-14H2,2-8H3,(H,25,27)/t16-,17-,18+,19+,20-,21-,24-/m1/s1 |
| InChIKey | PWJRBEMLVTZJOH-ZLLFTOHXSA-N |
| XLogP | 2.43 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|