C21H20Br4O4 — CID 89020634
(2S)-2-[[3,5-dibromo-2-[3-[2,4-dibromo-6-(oxiran-2-ylmethyl)phenoxy]propoxy]phenyl]methyl]oxirane (PubChem CID 89020634) has the molecular formula C21H20Br4O4 and a molecular weight of 656.00 g/mol. Its IUPAC name is (2S)-2-[[3,5-dibromo-2-[3-[2,4-dibromo-6-(oxiran-2-ylmethyl)phenoxy]propoxy]phenyl]methyl]oxirane.
| Compound Name | (2S)-2-[[3,5-dibromo-2-[3-[2,4-dibromo-6-(oxiran-2-ylmethyl)phenoxy]propoxy]phenyl]methyl]oxirane |
|---|---|
| PubChem CID | 89020634 |
| Molecular Formula | C21H20Br4O4 |
| Molecular Weight | 656.00 g/mol |
| Exact Mass | 651.81 |
| IUPAC Name | (2S)-2-[[3,5-dibromo-2-[3-[2,4-dibromo-6-(oxiran-2-ylmethyl)phenoxy]propoxy]phenyl]methyl]oxirane |
| SMILES | Brc1cc(Br)c(OCCCOc2c(Br)cc(Br)cc2C[C@H]2CO2)c(CC2CO2)c1 |
| InChI | InChI=1S/C21H20Br4O4/c22-14-4-12(6-16-10-28-16)20(18(24)8-14)26-2-1-3-27-21-13(7-17-11-29-17)5-15(23)9-19(21)25/h4-5,8-9,16-17H,1-3,6-7,10-11H2/t16-,17?/m0/s1 |
| InChIKey | JRHSGVYNODJPFL-BHWOMJMDSA-N |
| XLogP | 6.47 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.00 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|