About 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine
4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine (PubChem CID 89020672) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine.
Molecular Properties
| Compound Name | 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine |
| PubChem CID | 89020672 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine |
| SMILES | CCN1CCN=C(NOO)C1 |
| InChI | InChI=1S/C6H13N3O2/c1-2-9-4-3-7-6(5-9)8-11-10/h10H,2-5H2,1H3,(H,7,8) |
| InChIKey | LJRGXRGGRQBZIQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine?
The IUPAC name of 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine (CID 89020672) is 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine.
What is the SMILES notation for 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine?
The canonical SMILES for 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine is CCN1CCN=C(NOO)C1.
What is the InChIKey of 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine?
The InChIKey is LJRGXRGGRQBZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2/c1-2-9-4-3-7-6(5-9)8-11-10/h10H,2-5H2,1H3,(H,7,8).
What are the key properties of 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine?
4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine has a molecular weight of 159.19 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-hydroperoxy-3,5-dihydro-2H-pyrazin-6-amine is sourced from PubChem (CID 89020672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).