About 3-bromo-3,8-diazabicyclo[3.2.1]octane
3-bromo-3,8-diazabicyclo[3.2.1]octane (PubChem CID 89020719) has the molecular formula C6H11BrN2
and a molecular weight of 191.07 g/mol. Its IUPAC name is 3-bromo-3,8-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 3-bromo-3,8-diazabicyclo[3.2.1]octane |
| PubChem CID | 89020719 |
| Molecular Formula | C6H11BrN2 |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 3-bromo-3,8-diazabicyclo[3.2.1]octane |
| SMILES | BrN1CC2CCC(C1)N2 |
| InChI | InChI=1S/C6H11BrN2/c7-9-3-5-1-2-6(4-9)8-5/h5-6,8H,1-4H2 |
| InChIKey | DBHWFYGEJVSDDK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-3,8-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-3,8-diazabicyclo[3.2.1]octane?
The IUPAC name of 3-bromo-3,8-diazabicyclo[3.2.1]octane (CID 89020719) is 3-bromo-3,8-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 3-bromo-3,8-diazabicyclo[3.2.1]octane?
The canonical SMILES for 3-bromo-3,8-diazabicyclo[3.2.1]octane is BrN1CC2CCC(C1)N2.
What is the InChIKey of 3-bromo-3,8-diazabicyclo[3.2.1]octane?
The InChIKey is DBHWFYGEJVSDDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrN2/c7-9-3-5-1-2-6(4-9)8-5/h5-6,8H,1-4H2.
What are the key properties of 3-bromo-3,8-diazabicyclo[3.2.1]octane?
3-bromo-3,8-diazabicyclo[3.2.1]octane has a molecular weight of 191.07 g/mol, XLogP of 0.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-3,8-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 89020719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).