About 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid
4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid (PubChem CID 89020811) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid |
| PubChem CID | 89020811 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid |
| SMILES | O=C(O)C1CC(C2CC2)=CS1 |
| InChI | InChI=1S/C8H10O2S/c9-8(10)7-3-6(4-11-7)5-1-2-5/h4-5,7H,1-3H2,(H,9,10) |
| InChIKey | ILEZJZSIHHLCHT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid?
The IUPAC name of 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid (CID 89020811) is 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid is O=C(O)C1CC(C2CC2)=CS1.
What is the InChIKey of 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid?
The InChIKey is ILEZJZSIHHLCHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c9-8(10)7-3-6(4-11-7)5-1-2-5/h4-5,7H,1-3H2,(H,9,10).
What are the key properties of 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid?
4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid has a molecular weight of 170.23 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2,3-dihydrothiophene-2-carboxylic acid is sourced from PubChem (CID 89020811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).