About 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine
2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine (PubChem CID 89021094) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 89021094 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine |
| SMILES | CC1=NC2C=CN=CC2N1 |
| InChI | InChI=1S/C7H9N3/c1-5-9-6-2-3-8-4-7(6)10-5/h2-4,6-7H,1H3,(H,9,10) |
| InChIKey | TWDBJVXUKNLESU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine (CID 89021094) is 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine is CC1=NC2C=CN=CC2N1.
What is the InChIKey of 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine?
The InChIKey is TWDBJVXUKNLESU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-5-9-6-2-3-8-4-7(6)10-5/h2-4,6-7H,1H3,(H,9,10).
What are the key properties of 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine?
2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine has a molecular weight of 135.17 g/mol, XLogP of 0.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3a,7a-dihydro-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 89021094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).