About (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol
(3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol (PubChem CID 89021103) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol |
| PubChem CID | 89021103 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol |
| SMILES | C=C1C(=C)[C@@H](O)CN(C)C1=C |
| InChI | InChI=1S/C9H13NO/c1-6-7(2)9(11)5-10(4)8(6)3/h9,11H,1-3,5H2,4H3/t9-/m0/s1 |
| InChIKey | XOUDWBAGHLBCFG-VIFPVBQESA-N |
| XLogP | 0.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol?
The IUPAC name of (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol (CID 89021103) is (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol.
What is the SMILES notation for (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol?
The canonical SMILES for (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol is C=C1C(=C)[C@@H](O)CN(C)C1=C.
What is the InChIKey of (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol?
The InChIKey is XOUDWBAGHLBCFG-VIFPVBQESA-N. The full InChI is InChI=1S/C9H13NO/c1-6-7(2)9(11)5-10(4)8(6)3/h9,11H,1-3,5H2,4H3/t9-/m0/s1.
What are the key properties of (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol?
(3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol has a molecular weight of 151.21 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-methyl-4,5,6-trimethylidenepiperidin-3-ol is sourced from PubChem (CID 89021103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).