C44H34F12O10 — CID 89021161
[4-[4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenoxy]carbonylphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 89021161) has the molecular formula C44H34F12O10 and a molecular weight of 950.72 g/mol. Its IUPAC name is [4-[4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenoxy]carbonylphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [4-[4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenoxy]carbonylphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 89021161 |
| Molecular Formula | C44H34F12O10 |
| Molecular Weight | 950.72 g/mol |
| Exact Mass | 950.20 |
| IUPAC Name | [4-[4-[4-(4-prop-2-enoyloxybutoxy)-2,3-bis(trifluoromethyl)phenyl]-2,3-bis(trifluoromethyl)phenoxy]carbonylphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(-c4ccc(OCCCCOC(=O)C=C)c(C(F)(F)F)c4C(F)(F)F)c(C(F)(F)F)c3C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C44H34F12O10/c1-3-33(57)63-23-7-5-21-61-27-13-9-25(10-14-27)39(59)65-28-15-11-26(12-16-28)40(60)66-32-20-18-30(36(42(48,49)50)38(32)44(54,55)56)29-17-19-31(62-22-6-8-24-64-34(58)4-2)37(43(51,52)53)35(29)41(45,46)47/h3-4,9-20H,1-2,5-8,21-24H2 |
| InChIKey | YAOJDRJJRTULEQ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.72 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|