C23H17BF2N4O — CID 89021264
CID 89021264 (PubChem CID 89021264) has the molecular formula C23H17BF2N4O and a molecular weight of 414.22 g/mol.
| Compound Name | CID 89021264 |
|---|---|
| PubChem CID | 89021264 |
| Molecular Formula | C23H17BF2N4O |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | — |
| SMILES | [B]N(Cc1cnc(C)c(OCc2cccc(C#N)c2)c1C(F)F)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H17BF2N4O/c1-15-22(31-14-18-4-2-3-17(9-18)11-28)21(23(25)26)19(12-29-15)13-30(24)20-7-5-16(10-27)6-8-20/h2-9,12,23H,13-14H2,1H3 |
| InChIKey | OXTOUQVSXQMWJZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|