C20H19ClF3N3O — CID 89021380
2-chloro-4-[[(2S)-1-(ethylamino)-4-oxobutan-2-yl]-[(2,3,4-trifluorophenyl)methyl]amino]benzonitrile (PubChem CID 89021380) has the molecular formula C20H19ClF3N3O and a molecular weight of 409.84 g/mol. Its IUPAC name is 2-chloro-4-[[(2S)-1-(ethylamino)-4-oxobutan-2-yl]-[(2,3,4-trifluorophenyl)methyl]amino]benzonitrile.
| Compound Name | 2-chloro-4-[[(2S)-1-(ethylamino)-4-oxobutan-2-yl]-[(2,3,4-trifluorophenyl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 89021380 |
| Molecular Formula | C20H19ClF3N3O |
| Molecular Weight | 409.84 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-chloro-4-[[(2S)-1-(ethylamino)-4-oxobutan-2-yl]-[(2,3,4-trifluorophenyl)methyl]amino]benzonitrile |
| SMILES | CCNC[C@H](CC=O)N(Cc1ccc(F)c(F)c1F)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClF3N3O/c1-2-26-11-16(7-8-28)27(15-5-3-13(10-25)17(21)9-15)12-14-4-6-18(22)20(24)19(14)23/h3-6,8-9,16,26H,2,7,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | LTJFJBIZRXXODE-INIZCTEOSA-N |
| XLogP | 4.20 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|