About (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide
(E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide (PubChem CID 89021582) has the molecular formula C26H50N2O6
and a molecular weight of 486.69 g/mol. Its IUPAC name is (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide.
Molecular Properties
| Compound Name | (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide |
| PubChem CID | 89021582 |
| Molecular Formula | C26H50N2O6 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide |
| SMILES | CC(C)(C)OCCOC(C)(C)CCNC(=O)/C=C/C(=O)NCCC(C)(C)OCCOC(C)(C)C |
| InChI | InChI=1S/C26H50N2O6/c1-23(2,3)31-17-19-33-25(7,8)13-15-27-21(29)11-12-22(30)28-16-14-26(9,10)34-20-18-32-24(4,5)6/h11-12H,13-20H2,1-10H3,(H,27,29)(H,28,30)/b12-11+ |
| InChIKey | YVWWDGACVOOVMD-VAWYXSNFSA-N |
| XLogP | 3.78 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide?
The IUPAC name of (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide (CID 89021582) is (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide.
What is the SMILES notation for (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide?
The canonical SMILES for (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide is CC(C)(C)OCCOC(C)(C)CCNC(=O)/C=C/C(=O)NCCC(C)(C)OCCOC(C)(C)C.
What is the InChIKey of (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide?
The InChIKey is YVWWDGACVOOVMD-VAWYXSNFSA-N. The full InChI is InChI=1S/C26H50N2O6/c1-23(2,3)31-17-19-33-25(7,8)13-15-27-21(29)11-12-22(30)28-16-14-26(9,10)34-20-18-32-24(4,5)6/h11-12H,13-20H2,1-10H3,(H,27,29)(H,28,30)/b12-11+.
What are the key properties of (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide?
(E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide has a molecular weight of 486.69 g/mol, XLogP of 3.78, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-bis[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butyl]but-2-enediamide is sourced from PubChem (CID 89021582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).