C28H52O8 — CID 89021950
methyl (2S)-2-hydroxy-2-[(2R,5R)-3,4,5-tributoxy-6-(butoxymethyl)-2-prop-2-enyloxan-2-yl]acetate (PubChem CID 89021950) has the molecular formula C28H52O8 and a molecular weight of 516.72 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-2-[(2R,5R)-3,4,5-tributoxy-6-(butoxymethyl)-2-prop-2-enyloxan-2-yl]acetate.
| Compound Name | methyl (2S)-2-hydroxy-2-[(2R,5R)-3,4,5-tributoxy-6-(butoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 89021950 |
| Molecular Formula | C28H52O8 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | methyl (2S)-2-hydroxy-2-[(2R,5R)-3,4,5-tributoxy-6-(butoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
| SMILES | C=CC[C@]1([C@H](O)C(=O)OC)OC(COCCCC)[C@@H](OCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C28H52O8/c1-7-12-17-32-21-22-23(33-18-13-8-2)24(34-19-14-9-3)26(35-20-15-10-4)28(36-22,16-11-5)25(29)27(30)31-6/h11,22-26,29H,5,7-10,12-21H2,1-4,6H3/t22?,23-,24?,25-,26?,28-/m1/s1 |
| InChIKey | QWHKAOIAZGDQOV-ADKAAEQSSA-N |
| XLogP | 4.61 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|