C11H18INO — CID 89022011
6-cyclohexyl-2-iodo-1,2,3,6-tetrahydropyridin-5-ol (PubChem CID 89022011) has the molecular formula C11H18INO and a molecular weight of 307.18 g/mol. Its IUPAC name is 6-cyclohexyl-2-iodo-1,2,3,6-tetrahydropyridin-5-ol.
| Compound Name | 6-cyclohexyl-2-iodo-1,2,3,6-tetrahydropyridin-5-ol |
|---|---|
| PubChem CID | 89022011 |
| Molecular Formula | C11H18INO |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 6-cyclohexyl-2-iodo-1,2,3,6-tetrahydropyridin-5-ol |
| SMILES | OC1=CCC(I)NC1C1CCCCC1 |
| InChI | InChI=1S/C11H18INO/c12-10-7-6-9(14)11(13-10)8-4-2-1-3-5-8/h6,8,10-11,13-14H,1-5,7H2 |
| InChIKey | WXTYDOROCLHDBV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|