C18H29NO2 — CID 89022093
4-[(Z)-6-amino-5-hydroxy-7-methyl-2-methylideneoct-3-enyl]-3,5-dimethylcyclohexa-1,5-dien-1-ol (PubChem CID 89022093) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-[(Z)-6-amino-5-hydroxy-7-methyl-2-methylideneoct-3-enyl]-3,5-dimethylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-[(Z)-6-amino-5-hydroxy-7-methyl-2-methylideneoct-3-enyl]-3,5-dimethylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 89022093 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 4-[(Z)-6-amino-5-hydroxy-7-methyl-2-methylideneoct-3-enyl]-3,5-dimethylcyclohexa-1,5-dien-1-ol |
| SMILES | C=C(/C=C\C(O)C(N)C(C)C)CC1C(C)=CC(O)=CC1C |
| InChI | InChI=1S/C18H29NO2/c1-11(2)18(19)17(21)7-6-12(3)8-16-13(4)9-15(20)10-14(16)5/h6-7,9-11,13,16-18,20-21H,3,8,19H2,1-2,4-5H3/b7-6- |
| InChIKey | PXTBXHQJXYPWMV-SREVYHEPSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|