C22H23CoF17O6S-2 — CID 89022115
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-[2-(2-hydroxypropoxy)-2-oxoethyl]sulfanyl-2-methylpropanoate;oxocobalt;prop-1-ene (PubChem CID 89022115) has the molecular formula C22H23CoF17O6S-2 and a molecular weight of 797.39 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-[2-(2-hydroxypropoxy)-2-oxoethyl]sulfanyl-2-methylpropanoate;oxocobalt;prop-1-ene.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-[2-(2-hydroxypropoxy)-2-oxoethyl]sulfanyl-2-methylpropanoate;oxocobalt;prop-1-ene |
|---|---|
| PubChem CID | 89022115 |
| Molecular Formula | C22H23CoF17O6S-2 |
| Molecular Weight | 797.39 g/mol |
| Exact Mass | 797.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-[2-(2-hydroxypropoxy)-2-oxoethyl]sulfanyl-2-methylpropanoate;oxocobalt;prop-1-ene |
| SMILES | C=[C-]C.O=[Co].[CH2-]C(O)COC(=O)CSCC(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H18F17O5S.C3H5.Co.O/c1-8(6-42-7-10(38)41-5-9(2)37)11(39)40-4-3-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36;1-3-2;;/h8-9,37H,2-7H2,1H3;1H2,2H3;;/q2*-1;; |
| InChIKey | UWSBOWSGTMQXIX-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.39 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|