C8H11F6NO2 — CID 89022124
2,2,3,3,4,4-hexafluoro-4-morpholin-4-ylbutan-1-ol (PubChem CID 89022124) has the molecular formula C8H11F6NO2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-morpholin-4-ylbutan-1-ol.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-morpholin-4-ylbutan-1-ol |
|---|---|
| PubChem CID | 89022124 |
| Molecular Formula | C8H11F6NO2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-morpholin-4-ylbutan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C8H11F6NO2/c9-6(10,5-16)7(11,12)8(13,14)15-1-3-17-4-2-15/h16H,1-5H2 |
| InChIKey | GJKJISCIWZQICA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|