C15H16IOSi+ — CID 89022182
8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yloxy(trimethyl)silane (PubChem CID 89022182) has the molecular formula C15H16IOSi+ and a molecular weight of 367.28 g/mol. Its IUPAC name is 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yloxy(trimethyl)silane.
| Compound Name | 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yloxy(trimethyl)silane |
|---|---|
| PubChem CID | 89022182 |
| Molecular Formula | C15H16IOSi+ |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 8-iodoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-4-yloxy(trimethyl)silane |
| SMILES | C[Si](C)(C)Oc1ccc2c(c1)-c1ccccc1[I+]2 |
| InChI | InChI=1S/C15H16IOSi/c1-18(2,3)17-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16-15/h4-10H,1-3H3/q+1 |
| InChIKey | JTYJKIAOEUYKQL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|