C7H10F6O5S — CID 89022299
1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 89022299) has the molecular formula C7H10F6O5S and a molecular weight of 320.21 g/mol. Its IUPAC name is 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 89022299 |
| Molecular Formula | C7H10F6O5S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 1-(2-ethoxyethoxy)-1,1,2,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | CCOCCOC(F)(F)C(F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C7H10F6O5S/c1-2-17-3-4-18-7(12,13)5(8,6(9,10)11)19(14,15)16/h2-4H2,1H3,(H,14,15,16) |
| InChIKey | DWQITISMIKVYRO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|