C17H26FN — CID 89022338
3-[(1E,3Z,5Z)-3-(1-fluoroethyl)hepta-1,3,5-trienyl]-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 89022338) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is 3-[(1E,3Z,5Z)-3-(1-fluoroethyl)hepta-1,3,5-trienyl]-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-[(1E,3Z,5Z)-3-(1-fluoroethyl)hepta-1,3,5-trienyl]-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 89022338 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 3-[(1E,3Z,5Z)-3-(1-fluoroethyl)hepta-1,3,5-trienyl]-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | C/C=C\C=C(\C=C\C1CC2CCC(C1)N2C)C(C)F |
| InChI | InChI=1S/C17H26FN/c1-4-5-6-15(13(2)18)8-7-14-11-16-9-10-17(12-14)19(16)3/h4-8,13-14,16-17H,9-12H2,1-3H3/b5-4-,8-7+,15-6- |
| InChIKey | UJAZTRVSAXGRAJ-BVEIONQDSA-N |
| XLogP | 4.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|