C23H38FNO3 — CID 89022359
tert-butyl 2-ethyl-4-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienoxy]-6-methylpiperidine-1-carboxylate (PubChem CID 89022359) has the molecular formula C23H38FNO3 and a molecular weight of 395.56 g/mol. Its IUPAC name is tert-butyl 2-ethyl-4-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienoxy]-6-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-ethyl-4-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienoxy]-6-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 89022359 |
| Molecular Formula | C23H38FNO3 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | tert-butyl 2-ethyl-4-[(4E,6Z,8E)-9-fluoro-4-methylnona-4,6,8-trienoxy]-6-methylpiperidine-1-carboxylate |
| SMILES | CCC1CC(OCCC/C(C)=C/C=C\C=C\F)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38FNO3/c1-7-20-17-21(16-19(3)25(20)22(26)28-23(4,5)6)27-15-11-13-18(2)12-9-8-10-14-24/h8-10,12,14,19-21H,7,11,13,15-17H2,1-6H3/b9-8-,14-10+,18-12+ |
| InChIKey | WMSYRRXVKIAXQB-VUAWGKDFSA-N |
| XLogP | 6.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|