C27H34F3N5O2 — CID 89022527
2-[4-[4-[[amino(propan-2-yl)carbamoyl]-ethenylamino]phenyl]piperidin-1-yl]-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 89022527) has the molecular formula C27H34F3N5O2 and a molecular weight of 517.60 g/mol. Its IUPAC name is 2-[4-[4-[[amino(propan-2-yl)carbamoyl]-ethenylamino]phenyl]piperidin-1-yl]-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-[4-[[amino(propan-2-yl)carbamoyl]-ethenylamino]phenyl]piperidin-1-yl]-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 89022527 |
| Molecular Formula | C27H34F3N5O2 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 2-[4-[4-[[amino(propan-2-yl)carbamoyl]-ethenylamino]phenyl]piperidin-1-yl]-2-phenyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=CN(C(=O)N(N)C(C)C)c1ccc(C2CCN(C(C(=O)NCC(F)(F)F)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H34F3N5O2/c1-4-34(26(37)35(31)19(2)3)23-12-10-20(11-13-23)21-14-16-33(17-15-21)24(22-8-6-5-7-9-22)25(36)32-18-27(28,29)30/h4-13,19,21,24H,1,14-18,31H2,2-3H3,(H,32,36) |
| InChIKey | SVFFERMLUCPABR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|