C21H36O — CID 89022968
(5Z,8Z,11Z,13E,15R)-15-methoxyicosa-5,8,11,13-tetraene (PubChem CID 89022968) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is (5Z,8Z,11Z,13E,15R)-15-methoxyicosa-5,8,11,13-tetraene.
| Compound Name | (5Z,8Z,11Z,13E,15R)-15-methoxyicosa-5,8,11,13-tetraene |
|---|---|
| PubChem CID | 89022968 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | (5Z,8Z,11Z,13E,15R)-15-methoxyicosa-5,8,11,13-tetraene |
| SMILES | CCCC/C=C\C/C=C\C/C=C\C=C\[C@@H](CCCCC)OC |
| InChI | InChI=1S/C21H36O/c1-4-6-8-9-10-11-12-13-14-15-16-18-20-21(22-3)19-17-7-5-2/h9-10,12-13,15-16,18,20-21H,4-8,11,14,17,19H2,1-3H3/b10-9-,13-12-,16-15-,20-18+/t21-/m1/s1 |
| InChIKey | FXPKKLOBFVJQAX-HAVVVQIESA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|