C16H20N2O2S — CID 890231
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide (PubChem CID 890231) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 890231 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1R,2S)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)CSc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H20N2O2S/c1-11-6-2-3-7-12(11)17-15(19)10-21-16-18-13-8-4-5-9-14(13)20-16/h4-5,8-9,11-12H,2-3,6-7,10H2,1H3,(H,17,19)/t11-,12+/m0/s1 |
| InChIKey | IWGIROCRRGWDRW-NWDGAFQWSA-N |
| XLogP | 3.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |