C44H54F2O4S2 — CID 89023117
[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate (PubChem CID 89023117) has the molecular formula C44H54F2O4S2 and a molecular weight of 749.04 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate.
| Compound Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
|---|---|
| PubChem CID | 89023117 |
| Molecular Formula | C44H54F2O4S2 |
| Molecular Weight | 749.04 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 5-(2,4-difluorophenyl)-2-hydroxybenzoate |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC(=O)c2cc(-c3ccc(F)cc3F)ccc2O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C44H54F2O4S2/c1-40(2,3)31-21-27(22-32(37(31)48)41(4,5)6)51-44(13,14)52-28-23-33(42(7,8)9)38(34(24-28)43(10,11)12)50-39(49)30-19-25(15-18-36(30)47)29-17-16-26(45)20-35(29)46/h15-24,47-48H,1-14H3 |
| InChIKey | FXOYBEHBMNCMKE-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.04 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|