C46H56F2O5S2 — CID 89023118
[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(2,4-difluorophenyl)benzoate (PubChem CID 89023118) has the molecular formula C46H56F2O5S2 and a molecular weight of 791.08 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(2,4-difluorophenyl)benzoate.
| Compound Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(2,4-difluorophenyl)benzoate |
|---|---|
| PubChem CID | 89023118 |
| Molecular Formula | C46H56F2O5S2 |
| Molecular Weight | 791.08 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | [2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl] 2-acetyloxy-5-(2,4-difluorophenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)Oc1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C46H56F2O5S2/c1-26(49)52-38-19-16-27(31-18-17-28(47)21-37(31)48)20-32(38)41(51)53-40-35(44(8,9)10)24-30(25-36(40)45(11,12)13)55-46(14,15)54-29-22-33(42(2,3)4)39(50)34(23-29)43(5,6)7/h16-25,50H,1-15H3 |
| InChIKey | CCNTWRAEXMXYNS-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.08 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|