C42H57Cl2NO3 — CID 89023148
[2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 89023148) has the molecular formula C42H57Cl2NO3 and a molecular weight of 694.83 g/mol. Its IUPAC name is [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 89023148 |
| Molecular Formula | C42H57Cl2NO3 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | [2,5,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | Cc1cc(OC(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)c(C)c2c1OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C42H57Cl2NO3/c1-28(2)14-10-15-29(3)16-11-17-30(4)18-13-24-42(7)25-23-34-32(6)38(26-31(5)41(34)48-42)47-39(46)27-33-19-8-9-22-37(33)45-40-35(43)20-12-21-36(40)44/h8-9,12,19-22,26,28-30,45H,10-11,13-18,23-25,27H2,1-7H3 |
| InChIKey | KHKCPYLPORJJLA-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|