C17H30N2O3S3 — CID 8902315
[2-[cyclohexyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 8902315) has the molecular formula C17H30N2O3S3 and a molecular weight of 406.64 g/mol. Its IUPAC name is [2-[cyclohexyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[cyclohexyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8902315 |
| Molecular Formula | C17H30N2O3S3 |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [2-[cyclohexyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)N(C1CCCCC1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H30N2O3S3/c1-3-18(4-2)17(23)24-12-16(20)19(14-8-6-5-7-9-14)15-10-11-25(21,22)13-15/h14-15H,3-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | DWMRUJXYNOQXHL-OAHLLOKOSA-N |
| XLogP | 2.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|